C19H14O3 — CID 101184968
3'-phenylspiro[4H-naphthalene-2,2'-cyclobutane]-1,1',3-trione (PubChem CID 101184968) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3'-phenylspiro[4H-naphthalene-2,2'-cyclobutane]-1,1',3-trione.
| Compound Name | 3'-phenylspiro[4H-naphthalene-2,2'-cyclobutane]-1,1',3-trione |
|---|---|
| PubChem CID | 101184968 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3'-phenylspiro[4H-naphthalene-2,2'-cyclobutane]-1,1',3-trione |
| SMILES | O=C1Cc2ccccc2C(=O)C12C(=O)CC2c1ccccc1 |
| InChI | InChI=1S/C19H14O3/c20-16-10-13-8-4-5-9-14(13)18(22)19(16)15(11-17(19)21)12-6-2-1-3-7-12/h1-9,15H,10-11H2 |
| InChIKey | PWVSFPHKOFKIAD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|