C23H16O2S — CID 177425919
(2S,3R)-2-phenylspiro[2H-thiochromene-3,2'-3H-indene]-1',4-dione (PubChem CID 177425919) has the molecular formula C23H16O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is (2S,3R)-2-phenylspiro[2H-thiochromene-3,2'-3H-indene]-1',4-dione.
| Compound Name | (2S,3R)-2-phenylspiro[2H-thiochromene-3,2'-3H-indene]-1',4-dione |
|---|---|
| PubChem CID | 177425919 |
| Molecular Formula | C23H16O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (2S,3R)-2-phenylspiro[2H-thiochromene-3,2'-3H-indene]-1',4-dione |
| SMILES | O=C1c2ccccc2C[C@]12C(=O)c1ccccc1S[C@H]2c1ccccc1 |
| InChI | InChI=1S/C23H16O2S/c24-20-17-11-5-4-10-16(17)14-23(20)21(25)18-12-6-7-13-19(18)26-22(23)15-8-2-1-3-9-15/h1-13,22H,14H2/t22-,23+/m0/s1 |
| InChIKey | JEDAMVMNYNQXQG-XZOQPEGZSA-N |
| XLogP | 5.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|