C19H16O4 — CID 91171114
3',4'-dimethoxy-2,2'-spirobi[3H-indene]-1,1'-dione (PubChem CID 91171114) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is 3',4'-dimethoxy-2,2'-spirobi[3H-indene]-1,1'-dione.
| Compound Name | 3',4'-dimethoxy-2,2'-spirobi[3H-indene]-1,1'-dione |
|---|---|
| PubChem CID | 91171114 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 3',4'-dimethoxy-2,2'-spirobi[3H-indene]-1,1'-dione |
| SMILES | COc1cccc2c1C(OC)C1(Cc3ccccc3C1=O)C2=O |
| InChI | InChI=1S/C19H16O4/c1-22-14-9-5-8-13-15(14)18(23-2)19(17(13)21)10-11-6-3-4-7-12(11)16(19)20/h3-9,18H,10H2,1-2H3 |
| InChIKey | GLUMNJVANBEWCQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|