C19H16O4 — CID 102281335
(2R,3'S)-3'-[(2R,3S)-3-(2-methoxyphenyl)oxiran-2-yl]spiro[3H-indene-2,2'-oxirane]-1-one (PubChem CID 102281335) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2R,3'S)-3'-[(2R,3S)-3-(2-methoxyphenyl)oxiran-2-yl]spiro[3H-indene-2,2'-oxirane]-1-one.
| Compound Name | (2R,3'S)-3'-[(2R,3S)-3-(2-methoxyphenyl)oxiran-2-yl]spiro[3H-indene-2,2'-oxirane]-1-one |
|---|---|
| PubChem CID | 102281335 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2R,3'S)-3'-[(2R,3S)-3-(2-methoxyphenyl)oxiran-2-yl]spiro[3H-indene-2,2'-oxirane]-1-one |
| SMILES | COc1ccccc1[C@@H]1O[C@H]1[C@@H]1O[C@]12Cc1ccccc1C2=O |
| InChI | InChI=1S/C19H16O4/c1-21-14-9-5-4-8-13(14)15-16(22-15)18-19(23-18)10-11-6-2-3-7-12(11)17(19)20/h2-9,15-16,18H,10H2,1H3/t15-,16+,18-,19-/m0/s1 |
| InChIKey | ZBKNSCATBJFYGD-NBMJBFSESA-N |
| XLogP | 2.71 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|