C22H20O2 — CID 10686895
(1R,2R,10R)-8-methoxypentacyclo[11.8.0.02,10.04,9.016,21]henicosa-4(9),5,7,12,16,18,20-heptaen-3-one (PubChem CID 10686895) has the molecular formula C22H20O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1R,2R,10R)-8-methoxypentacyclo[11.8.0.02,10.04,9.016,21]henicosa-4(9),5,7,12,16,18,20-heptaen-3-one.
| Compound Name | (1R,2R,10R)-8-methoxypentacyclo[11.8.0.02,10.04,9.016,21]henicosa-4(9),5,7,12,16,18,20-heptaen-3-one |
|---|---|
| PubChem CID | 10686895 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1R,2R,10R)-8-methoxypentacyclo[11.8.0.02,10.04,9.016,21]henicosa-4(9),5,7,12,16,18,20-heptaen-3-one |
| SMILES | COc1cccc2c1[C@@H]1CC=C3CCc4ccccc4[C@@H]3[C@@H]1C2=O |
| InChI | InChI=1S/C22H20O2/c1-24-18-8-4-7-17-20(18)16-12-11-14-10-9-13-5-2-3-6-15(13)19(14)21(16)22(17)23/h2-8,11,16,19,21H,9-10,12H2,1H3/t16-,19+,21+/m0/s1 |
| InChIKey | BTBWWWKQHXNKNR-LDQXTDLNSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|