C16H12O2S — CID 92860308
(3S,3'S)-3'-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one (PubChem CID 92860308) has the molecular formula C16H12O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is (3S,3'S)-3'-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one.
| Compound Name | (3S,3'S)-3'-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one |
|---|---|
| PubChem CID | 92860308 |
| Molecular Formula | C16H12O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | (3S,3'S)-3'-phenylspiro[2H-thiochromene-3,2'-oxirane]-4-one |
| SMILES | O=C1c2ccccc2SC[C@@]12O[C@H]2c1ccccc1 |
| InChI | InChI=1S/C16H12O2S/c17-14-12-8-4-5-9-13(12)19-10-16(14)15(18-16)11-6-2-1-3-7-11/h1-9,15H,10H2/t15-,16+/m0/s1 |
| InChIKey | JPFYXLCKPJMWSF-JKSUJKDBSA-N |
| XLogP | 3.49 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|