C15H24O2SSi2 — CID 164713970
3-[dimethyl(trimethylsilyl)silyl]oxy-3-methyl-2H-thiochromen-4-one (PubChem CID 164713970) has the molecular formula C15H24O2SSi2 and a molecular weight of 324.59 g/mol. Its IUPAC name is 3-[dimethyl(trimethylsilyl)silyl]oxy-3-methyl-2H-thiochromen-4-one.
| Compound Name | 3-[dimethyl(trimethylsilyl)silyl]oxy-3-methyl-2H-thiochromen-4-one |
|---|---|
| PubChem CID | 164713970 |
| Molecular Formula | C15H24O2SSi2 |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 3-[dimethyl(trimethylsilyl)silyl]oxy-3-methyl-2H-thiochromen-4-one |
| SMILES | CC1(O[Si](C)(C)[Si](C)(C)C)CSc2ccccc2C1=O |
| InChI | InChI=1S/C15H24O2SSi2/c1-15(17-20(5,6)19(2,3)4)11-18-13-10-8-7-9-12(13)14(15)16/h7-10H,11H2,1-6H3 |
| InChIKey | NNVNLTLXCUWAFL-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|