C24H21FO5S2 — CID 134962241
(2S)-2-[2,2-bis(benzenesulfonyl)ethyl]-2-fluoro-3,4-dihydronaphthalen-1-one (PubChem CID 134962241) has the molecular formula C24H21FO5S2 and a molecular weight of 472.56 g/mol. Its IUPAC name is (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]-2-fluoro-3,4-dihydronaphthalen-1-one.
| Compound Name | (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]-2-fluoro-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 134962241 |
| Molecular Formula | C24H21FO5S2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]-2-fluoro-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1c2ccccc2CC[C@]1(F)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H21FO5S2/c25-24(16-15-18-9-7-8-14-21(18)23(24)26)17-22(31(27,28)19-10-3-1-4-11-19)32(29,30)20-12-5-2-6-13-20/h1-14,22H,15-17H2/t24-/m0/s1 |
| InChIKey | FOMWBPDTLXFYGQ-DEOSSOPVSA-N |
| XLogP | 4.19 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |