C15H13NO2 — CID 13004595
9-methyl-10-nitro-9,10-dihydroanthracene (PubChem CID 13004595) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 9-methyl-10-nitro-9,10-dihydroanthracene.
| Compound Name | 9-methyl-10-nitro-9,10-dihydroanthracene |
|---|---|
| PubChem CID | 13004595 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 9-methyl-10-nitro-9,10-dihydroanthracene |
| SMILES | CC1c2ccccc2C([N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C15H13NO2/c1-10-11-6-2-4-8-13(11)15(16(17)18)14-9-5-3-7-12(10)14/h2-10,15H,1H3 |
| InChIKey | DWOYWVBCPYYARB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|