C10H10N2O3 — CID 7073343
(4S,5R)-5-methyl-4-nitro-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 7073343) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is (4S,5R)-5-methyl-4-nitro-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | (4S,5R)-5-methyl-4-nitro-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 7073343 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (4S,5R)-5-methyl-4-nitro-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | C[C@H]1ON=C(c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O3/c1-7-10(12(13)14)9(11-15-7)8-5-3-2-4-6-8/h2-7,10H,1H3/t7-,10-/m1/s1 |
| InChIKey | YEFNMQSEXRXBDU-GMSGAONNSA-N |
| XLogP | 1.45 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|