C21H25N3O4 — CID 7407644
(2R,3R,5S,6S)-4,4-dimethyl-2,6-bis(2-methylphenyl)-3,5-dinitropiperidine (PubChem CID 7407644) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2R,3R,5S,6S)-4,4-dimethyl-2,6-bis(2-methylphenyl)-3,5-dinitropiperidine.
| Compound Name | (2R,3R,5S,6S)-4,4-dimethyl-2,6-bis(2-methylphenyl)-3,5-dinitropiperidine |
|---|---|
| PubChem CID | 7407644 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2R,3R,5S,6S)-4,4-dimethyl-2,6-bis(2-methylphenyl)-3,5-dinitropiperidine |
| SMILES | Cc1ccccc1[C@H]1N[C@@H](c2ccccc2C)[C@@H]([N+](=O)[O-])C(C)(C)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25N3O4/c1-13-9-5-7-11-15(13)17-19(23(25)26)21(3,4)20(24(27)28)18(22-17)16-12-8-6-10-14(16)2/h5-12,17-20,22H,1-4H3/t17-,18+,19+,20- |
| InChIKey | BYFACTYMSQYNAL-JVSBHGNQSA-N |
| XLogP | 4.01 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|