C15H17N3O6 — CID 11905247
(2S,3R,5R,6S)-2,6-bis(furan-2-yl)-4,4-dimethyl-3,5-dinitropiperidine (PubChem CID 11905247) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is (2S,3R,5R,6S)-2,6-bis(furan-2-yl)-4,4-dimethyl-3,5-dinitropiperidine.
| Compound Name | (2S,3R,5R,6S)-2,6-bis(furan-2-yl)-4,4-dimethyl-3,5-dinitropiperidine |
|---|---|
| PubChem CID | 11905247 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | (2S,3R,5R,6S)-2,6-bis(furan-2-yl)-4,4-dimethyl-3,5-dinitropiperidine |
| SMILES | CC1(C)[C@@H]([N+](=O)[O-])[C@@H](c2ccco2)N[C@H](c2ccco2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O6/c1-15(2)13(17(19)20)11(9-5-3-7-23-9)16-12(14(15)18(21)22)10-6-4-8-24-10/h3-8,11-14,16H,1-2H3/t11-,12-,13+,14+/m1/s1 |
| InChIKey | WKSGTJWBIMDLLN-MQYQWHSLSA-N |
| XLogP | 2.58 |
| TPSA | 124.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|