C10H11NO2 — CID 131123234
(3S,4S)-4-(furan-2-yl)-3-prop-1-en-2-ylazetidin-2-one (PubChem CID 131123234) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3S,4S)-4-(furan-2-yl)-3-prop-1-en-2-ylazetidin-2-one.
| Compound Name | (3S,4S)-4-(furan-2-yl)-3-prop-1-en-2-ylazetidin-2-one |
|---|---|
| PubChem CID | 131123234 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3S,4S)-4-(furan-2-yl)-3-prop-1-en-2-ylazetidin-2-one |
| SMILES | C=C(C)[C@@H]1C(=O)N[C@@H]1c1ccco1 |
| InChI | InChI=1S/C10H11NO2/c1-6(2)8-9(11-10(8)12)7-4-3-5-13-7/h3-5,8-9H,1H2,2H3,(H,11,12)/t8-,9+/m0/s1 |
| InChIKey | VKYFUHOFDADSFQ-DTWKUNHWSA-N |
| XLogP | 1.64 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|