C9H7N3O2S — CID 92529043
(4R,5R)-4-(furan-2-yl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile (PubChem CID 92529043) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is (4R,5R)-4-(furan-2-yl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile.
| Compound Name | (4R,5R)-4-(furan-2-yl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile |
|---|---|
| PubChem CID | 92529043 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | (4R,5R)-4-(furan-2-yl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile |
| SMILES | N#C[C@@H]1C(=O)NC(=S)N[C@H]1c1ccco1 |
| InChI | InChI=1S/C9H7N3O2S/c10-4-5-7(6-2-1-3-14-6)11-9(15)12-8(5)13/h1-3,5,7H,(H2,11,12,13,15)/t5-,7+/m0/s1 |
| InChIKey | GSWPIGZIDIXRMA-CAHLUQPWSA-N |
| XLogP | 0.46 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|