C13H13N3O3S — CID 92529031
(4R,5S)-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile (PubChem CID 92529031) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is (4R,5S)-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile.
| Compound Name | (4R,5S)-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile |
|---|---|
| PubChem CID | 92529031 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (4R,5S)-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidene-1,3-diazinane-5-carbonitrile |
| SMILES | COc1ccc([C@@H]2NC(=S)NC(=O)[C@@H]2C#N)cc1OC |
| InChI | InChI=1S/C13H13N3O3S/c1-18-9-4-3-7(5-10(9)19-2)11-8(6-14)12(17)16-13(20)15-11/h3-5,8,11H,1-2H3,(H2,15,16,17,20)/t8-,11+/m1/s1 |
| InChIKey | XLLOSRLOAGBNRT-KCJUWKMLSA-N |
| XLogP | 0.89 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|