C20H24N4O4S — CID 137227915
[5-cyano-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidenepiperidin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium (PubChem CID 137227915) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is [5-cyano-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidenepiperidin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium.
| Compound Name | [5-cyano-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidenepiperidin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 137227915 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [5-cyano-4-(3,4-dimethoxyphenyl)-6-oxo-2-sulfanylidenepiperidin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium |
| SMILES | COc1ccc(C2C(=C=[N-])C(=S)NC(=O)C2C#N)cc1OC.C[NH+]1CCOCC1 |
| InChI | InChI=1S/C15H12N3O3S.C5H11NO/c1-20-11-4-3-8(5-12(11)21-2)13-9(6-16)14(19)18-15(22)10(13)7-17;1-6-2-4-7-5-3-6/h3-5,9,13H,1-2H3,(H,18,19,22);2-5H2,1H3/q-1;/p+1 |
| InChIKey | BWXQZTGHDMSFLP-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|