C24H28N4O3S2 — CID 135549485
[5-[(2-methoxyphenyl)carbamoyl]-6-methyl-2-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium (PubChem CID 135549485) has the molecular formula C24H28N4O3S2 and a molecular weight of 484.65 g/mol. Its IUPAC name is [5-[(2-methoxyphenyl)carbamoyl]-6-methyl-2-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium.
| Compound Name | [5-[(2-methoxyphenyl)carbamoyl]-6-methyl-2-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 135549485 |
| Molecular Formula | C24H28N4O3S2 |
| Molecular Weight | 484.65 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | [5-[(2-methoxyphenyl)carbamoyl]-6-methyl-2-sulfanylidene-4-thiophen-2-yl-1,4-dihydropyridin-3-ylidene]methylideneazanide;4-methylmorpholin-4-ium |
| SMILES | COc1ccccc1NC(=O)C1=C(C)NC(=S)C(=C=[N-])C1c1cccs1.C[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H16N3O2S2.C5H11NO/c1-11-16(18(23)22-13-6-3-4-7-14(13)24-2)17(15-8-5-9-26-15)12(10-20)19(25)21-11;1-6-2-4-7-5-3-6/h3-9,17H,1-2H3,(H,21,25)(H,22,23);2-5H2,1H3/q-1;/p+1 |
| InChIKey | GSDDYWPFBIMBIR-UHFFFAOYSA-O |
| XLogP | 2.38 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|