C18H19N3O2S2 — CID 30201744
(6R)-N-(2-methoxyphenyl)-3,4-dimethyl-2-sulfanylidene-6-thiophen-2-yl-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 30201744) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (6R)-N-(2-methoxyphenyl)-3,4-dimethyl-2-sulfanylidene-6-thiophen-2-yl-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6R)-N-(2-methoxyphenyl)-3,4-dimethyl-2-sulfanylidene-6-thiophen-2-yl-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 30201744 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (6R)-N-(2-methoxyphenyl)-3,4-dimethyl-2-sulfanylidene-6-thiophen-2-yl-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1=C(C)N(C)C(=S)N[C@H]1c1cccs1 |
| InChI | InChI=1S/C18H19N3O2S2/c1-11-15(17(22)19-12-7-4-5-8-13(12)23-3)16(14-9-6-10-25-14)20-18(24)21(11)2/h4-10,16H,1-3H3,(H,19,22)(H,20,24)/t16-/m0/s1 |
| InChIKey | CAYBTGGUXAZWRO-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|