C12H8N4O3S — CID 3004331
N-(2-cyanophenyl)-2-oxo-2-(5-oxo-2-sulfanylideneimidazolidin-4-yl)acetamide (PubChem CID 3004331) has the molecular formula C12H8N4O3S and a molecular weight of 288.29 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-oxo-2-(5-oxo-2-sulfanylideneimidazolidin-4-yl)acetamide.
| Compound Name | N-(2-cyanophenyl)-2-oxo-2-(5-oxo-2-sulfanylideneimidazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 3004331 |
| Molecular Formula | C12H8N4O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-(2-cyanophenyl)-2-oxo-2-(5-oxo-2-sulfanylideneimidazolidin-4-yl)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)C(=O)C1NC(=S)NC1=O |
| InChI | InChI=1S/C12H8N4O3S/c13-5-6-3-1-2-4-7(6)14-11(19)9(17)8-10(18)16-12(20)15-8/h1-4,8H,(H,14,19)(H2,15,16,18,20) |
| InChIKey | ORACOXBRMZVSHL-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 111.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|