C13H11N3O5S — CID 4027497
methyl 5-cyano-4-[2-(furan-2-yl)-2-oxoethyl]-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate (PubChem CID 4027497) has the molecular formula C13H11N3O5S and a molecular weight of 321.31 g/mol. Its IUPAC name is methyl 5-cyano-4-[2-(furan-2-yl)-2-oxoethyl]-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate.
| Compound Name | methyl 5-cyano-4-[2-(furan-2-yl)-2-oxoethyl]-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate |
|---|---|
| PubChem CID | 4027497 |
| Molecular Formula | C13H11N3O5S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | methyl 5-cyano-4-[2-(furan-2-yl)-2-oxoethyl]-6-oxo-2-sulfanylidene-1,3-diazinane-4-carboxylate |
| SMILES | COC(=O)C1(CC(=O)c2ccco2)NC(=S)NC(=O)C1C#N |
| InChI | InChI=1S/C13H11N3O5S/c1-20-11(19)13(5-8(17)9-3-2-4-21-9)7(6-14)10(18)15-12(22)16-13/h2-4,7H,5H2,1H3,(H2,15,16,18,22) |
| InChIKey | WHTWVMJAKQYVDP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 121.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|