C12H16N2O4 — CID 102399859
5-acetyl-4-ethoxy-6-(furan-2-yl)-1,3-diazinan-2-one (PubChem CID 102399859) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-acetyl-4-ethoxy-6-(furan-2-yl)-1,3-diazinan-2-one.
| Compound Name | 5-acetyl-4-ethoxy-6-(furan-2-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 102399859 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 5-acetyl-4-ethoxy-6-(furan-2-yl)-1,3-diazinan-2-one |
| SMILES | CCOC1NC(=O)NC(c2ccco2)C1C(C)=O |
| InChI | InChI=1S/C12H16N2O4/c1-3-17-11-9(7(2)15)10(13-12(16)14-11)8-5-4-6-18-8/h4-6,9-11H,3H2,1-2H3,(H2,13,14,16) |
| InChIKey | ZMWBMKWJTGADNV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |