C10H9NO3 — CID 87514062
1-nitro-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 87514062) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1-nitro-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 1-nitro-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 87514062 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | 1-nitro-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2ccccc2C1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9NO3/c12-9-6-5-7-3-1-2-4-8(7)10(9)11(13)14/h1-4,10H,5-6H2 |
| InChIKey | SHHDQVWBNVMDDG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|