C12H13NO2 — CID 70411002
1-[(E)-2-nitroethenyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 70411002) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-[(E)-2-nitroethenyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-[(E)-2-nitroethenyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 70411002 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1-[(E)-2-nitroethenyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=[N+]([O-])/C=C/C1CCCc2ccccc21 |
| InChI | InChI=1S/C12H13NO2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-2,4,7-9,11H,3,5-6H2/b9-8+ |
| InChIKey | KCSKISJFNRAVGA-CMDGGOBGSA-N |
| XLogP | 2.90 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|