C17H23N — CID 103983683
(4Z)-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylidene)azepane (PubChem CID 103983683) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (4Z)-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylidene)azepane.
| Compound Name | (4Z)-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylidene)azepane |
|---|---|
| PubChem CID | 103983683 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (4Z)-4-(1,2,3,4-tetrahydronaphthalen-1-ylmethylidene)azepane |
| SMILES | C(=C1/CCCNCC1)\C1CCCc2ccccc21 |
| InChI | InChI=1S/C17H23N/c1-2-9-17-15(6-1)7-3-8-16(17)13-14-5-4-11-18-12-10-14/h1-2,6,9,13,16,18H,3-5,7-8,10-12H2/b14-13- |
| InChIKey | RDSRFAGYGXMLLZ-YPKPFQOOSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|