C12H12O — CID 154243339
2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethenone (PubChem CID 154243339) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethenone.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethenone |
|---|---|
| PubChem CID | 154243339 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalen-1-yl)ethenone |
| SMILES | O=C=CC1CCCc2ccccc21 |
| InChI | InChI=1S/C12H12O/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-2,4,7-8,11H,3,5-6H2 |
| InChIKey | NPXCUUOLUNVXNX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|