C10H11BrO2S — CID 102537231
1,2,3,4-tetrahydronaphthalene-1-sulfonyl bromide (PubChem CID 102537231) has the molecular formula C10H11BrO2S and a molecular weight of 275.17 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalene-1-sulfonyl bromide.
| Compound Name | 1,2,3,4-tetrahydronaphthalene-1-sulfonyl bromide |
|---|---|
| PubChem CID | 102537231 |
| Molecular Formula | C10H11BrO2S |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalene-1-sulfonyl bromide |
| SMILES | O=S(=O)(Br)C1CCCc2ccccc21 |
| InChI | InChI=1S/C10H11BrO2S/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7H2 |
| InChIKey | HXSKHPONUZCFAX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |