C14H19NO4 — CID 154711383
1-tert-butylperoxy-2-nitro-1,2,3,4-tetrahydronaphthalene (PubChem CID 154711383) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-tert-butylperoxy-2-nitro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-tert-butylperoxy-2-nitro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 154711383 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-tert-butylperoxy-2-nitro-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)(C)OOC1c2ccccc2CCC1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19NO4/c1-14(2,3)19-18-13-11-7-5-4-6-10(11)8-9-12(13)15(16)17/h4-7,12-13H,8-9H2,1-3H3 |
| InChIKey | KIGJULQLSYIYEB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|