C19H26N2O6 — CID 139725441
ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)acetate (PubChem CID 139725441) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)acetate.
| Compound Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)acetate |
|---|---|
| PubChem CID | 139725441 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)acetate |
| SMILES | CCOC(=O)C(NC(=O)OC(C)(C)C)C1c2ccccc2CCC1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N2O6/c1-5-26-17(22)16(20-18(23)27-19(2,3)4)15-13-9-7-6-8-12(13)10-11-14(15)21(24)25/h6-9,14-16H,5,10-11H2,1-4H3,(H,20,23) |
| InChIKey | FLKDKAQZALXZHU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|