C14H16O2 — CID 150600443
(1R)-1-(3-oxobutyl)-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 150600443) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1R)-1-(3-oxobutyl)-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | (1R)-1-(3-oxobutyl)-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 150600443 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (1R)-1-(3-oxobutyl)-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | CC(=O)CC[C@H]1C(=O)CCc2ccccc21 |
| InChI | InChI=1S/C14H16O2/c1-10(15)6-8-13-12-5-3-2-4-11(12)7-9-14(13)16/h2-5,13H,6-9H2,1H3/t13-/m1/s1 |
| InChIKey | IRTKICMAAPSTKL-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |