C22H22NO2+ — CID 87920205
1,1-bis[(1R)-2,3-dihydro-1H-inden-1-yl]pyrrolidin-1-ium-2,5-dione (PubChem CID 87920205) has the molecular formula C22H22NO2+ and a molecular weight of 332.42 g/mol. Its IUPAC name is 1,1-bis[(1R)-2,3-dihydro-1H-inden-1-yl]pyrrolidin-1-ium-2,5-dione.
| Compound Name | 1,1-bis[(1R)-2,3-dihydro-1H-inden-1-yl]pyrrolidin-1-ium-2,5-dione |
|---|---|
| PubChem CID | 87920205 |
| Molecular Formula | C22H22NO2+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1,1-bis[(1R)-2,3-dihydro-1H-inden-1-yl]pyrrolidin-1-ium-2,5-dione |
| SMILES | O=C1CCC(=O)[N+]1([C@@H]1CCc2ccccc21)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C22H22NO2/c24-21-13-14-22(25)23(21,19-11-9-15-5-1-3-7-17(15)19)20-12-10-16-6-2-4-8-18(16)20/h1-8,19-20H,9-14H2/q+1/t19-,20-/m1/s1 |
| InChIKey | PUNPELDJPQZUGN-WOJBJXKFSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|