C19H18O — CID 11737107
2-(2,3-dihydro-1H-inden-1-yl)-2-methyl-3H-inden-1-one (PubChem CID 11737107) has the molecular formula C19H18O and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-1-yl)-2-methyl-3H-inden-1-one.
| Compound Name | 2-(2,3-dihydro-1H-inden-1-yl)-2-methyl-3H-inden-1-one |
|---|---|
| PubChem CID | 11737107 |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-1-yl)-2-methyl-3H-inden-1-one |
| SMILES | CC1(C2CCc3ccccc32)Cc2ccccc2C1=O |
| InChI | InChI=1S/C19H18O/c1-19(12-14-7-3-5-9-16(14)18(19)20)17-11-10-13-6-2-4-8-15(13)17/h2-9,17H,10-12H2,1H3 |
| InChIKey | CRRBHVBLIZJDCV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |