About 3-nitro-3H-indazole
3-nitro-3H-indazole (PubChem CID 173392250) has the molecular formula C7H5N3O2
and a molecular weight of 163.14 g/mol. Its IUPAC name is 3-nitro-3H-indazole.
Molecular Properties
| Compound Name | 3-nitro-3H-indazole |
| PubChem CID | 173392250 |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | 3-nitro-3H-indazole |
| SMILES | O=[N+]([O-])C1N=Nc2ccccc21 |
| InChI | InChI=1S/C7H5N3O2/c11-10(12)7-5-3-1-2-4-6(5)8-9-7/h1-4,7H |
| InChIKey | CNOHJGGDGAANBV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 67.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-3H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-3H-indazole?
The IUPAC name of 3-nitro-3H-indazole (CID 173392250) is 3-nitro-3H-indazole.
What is the SMILES notation for 3-nitro-3H-indazole?
The canonical SMILES for 3-nitro-3H-indazole is O=[N+]([O-])C1N=Nc2ccccc21.
What is the InChIKey of 3-nitro-3H-indazole?
The InChIKey is CNOHJGGDGAANBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O2/c11-10(12)7-5-3-1-2-4-6(5)8-9-7/h1-4,7H.
What are the key properties of 3-nitro-3H-indazole?
3-nitro-3H-indazole has a molecular weight of 163.14 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-3H-indazole is sourced from PubChem (CID 173392250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).