C21H17N3O2 — CID 135070641
4-(nitromethyl)-2,3-diphenyl-4H-quinazoline (PubChem CID 135070641) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-(nitromethyl)-2,3-diphenyl-4H-quinazoline.
| Compound Name | 4-(nitromethyl)-2,3-diphenyl-4H-quinazoline |
|---|---|
| PubChem CID | 135070641 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-(nitromethyl)-2,3-diphenyl-4H-quinazoline |
| SMILES | O=[N+]([O-])CC1c2ccccc2N=C(c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C21H17N3O2/c25-23(26)15-20-18-13-7-8-14-19(18)22-21(16-9-3-1-4-10-16)24(20)17-11-5-2-6-12-17/h1-14,20H,15H2 |
| InChIKey | QHGJLHDDQAZKEC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|