About 3-bromo-3H-indazole
3-bromo-3H-indazole (PubChem CID 53412030) has the molecular formula C7H5BrN2
and a molecular weight of 197.04 g/mol. Its IUPAC name is 3-bromo-3H-indazole.
Molecular Properties
| Compound Name | 3-bromo-3H-indazole |
| PubChem CID | 53412030 |
| Molecular Formula | C7H5BrN2 |
| Molecular Weight | 197.04 g/mol |
| Exact Mass | 195.96 |
| IUPAC Name | 3-bromo-3H-indazole |
| SMILES | BrC1N=Nc2ccccc21 |
| InChI | InChI=1S/C7H5BrN2/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4,7H |
| InChIKey | WVKSBABKQYALGB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.04 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-3H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-3H-indazole?
The IUPAC name of 3-bromo-3H-indazole (CID 53412030) is 3-bromo-3H-indazole.
What is the SMILES notation for 3-bromo-3H-indazole?
The canonical SMILES for 3-bromo-3H-indazole is BrC1N=Nc2ccccc21.
What is the InChIKey of 3-bromo-3H-indazole?
The InChIKey is WVKSBABKQYALGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2/c8-7-5-3-1-2-4-6(5)9-10-7/h1-4,7H.
What are the key properties of 3-bromo-3H-indazole?
3-bromo-3H-indazole has a molecular weight of 197.04 g/mol, XLogP of 3.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-3H-indazole is sourced from PubChem (CID 53412030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).