C10H11N3O2 — CID 119089864
N-methyl-4-nitro-3,4-dihydroquinolin-3-amine (PubChem CID 119089864) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is N-methyl-4-nitro-3,4-dihydroquinolin-3-amine.
| Compound Name | N-methyl-4-nitro-3,4-dihydroquinolin-3-amine |
|---|---|
| PubChem CID | 119089864 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-methyl-4-nitro-3,4-dihydroquinolin-3-amine |
| SMILES | CNC1C=Nc2ccccc2C1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N3O2/c1-11-9-6-12-8-5-3-2-4-7(8)10(9)13(14)15/h2-6,9-11H,1H3 |
| InChIKey | NANUMTQMFJDYFA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|