About 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione
5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione (PubChem CID 174860981) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione.
Molecular Properties
| Compound Name | 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione |
| PubChem CID | 174860981 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione |
| SMILES | CC1C(=O)C=CC(=O)C1(C)c1ccccc1 |
| InChI | InChI=1S/C14H14O2/c1-10-12(15)8-9-13(16)14(10,2)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | WSQPQAXZZOTZFL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione?
The IUPAC name of 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione (CID 174860981) is 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione.
What is the SMILES notation for 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione?
The canonical SMILES for 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione is CC1C(=O)C=CC(=O)C1(C)c1ccccc1.
What is the InChIKey of 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione?
The InChIKey is WSQPQAXZZOTZFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2/c1-10-12(15)8-9-13(16)14(10,2)11-6-4-3-5-7-11/h3-10H,1-2H3.
What are the key properties of 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione?
5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione has a molecular weight of 214.26 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione is sourced from PubChem (CID 174860981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).