C14H14O2 — CID 174860981
5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione (PubChem CID 174860981) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione.
| Compound Name | 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 174860981 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 5,6-dimethyl-5-phenylcyclohex-2-ene-1,4-dione |
| SMILES | CC1C(=O)C=CC(=O)C1(C)c1ccccc1 |
| InChI | InChI=1S/C14H14O2/c1-10-12(15)8-9-13(16)14(10,2)11-6-4-3-5-7-11/h3-10H,1-2H3 |
| InChIKey | WSQPQAXZZOTZFL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |