C21H37N3S2 — CID 146326101
2-[2-[(3,4,11a-trimethyl-1,2,3,4,4a,5,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-9-yl)disulfanyl]ethyl]guanidine (PubChem CID 146326101) has the molecular formula C21H37N3S2 and a molecular weight of 395.68 g/mol. Its IUPAC name is 2-[2-[(3,4,11a-trimethyl-1,2,3,4,4a,5,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-9-yl)disulfanyl]ethyl]guanidine.
| Compound Name | 2-[2-[(3,4,11a-trimethyl-1,2,3,4,4a,5,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-9-yl)disulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 146326101 |
| Molecular Formula | C21H37N3S2 |
| Molecular Weight | 395.68 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-[2-[(3,4,11a-trimethyl-1,2,3,4,4a,5,7,8,9,10,11,11b-dodecahydrocyclohepta[a]naphthalen-9-yl)disulfanyl]ethyl]guanidine |
| SMILES | CC1CCC2C(CC=C3CCC(SSCCN=C(N)N)CCC32C)C1C |
| InChI | InChI=1S/C21H37N3S2/c1-14-4-9-19-18(15(14)2)8-6-16-5-7-17(10-11-21(16,19)3)26-25-13-12-24-20(22)23/h6,14-15,17-19H,4-5,7-13H2,1-3H3,(H4,22,23,24) |
| InChIKey | SCJHLASGWVWZLO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|