C20H29NOS — CID 167089420
(8R,9R,10R,14R)-17-isothiocyanato-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 167089420) has the molecular formula C20H29NOS and a molecular weight of 331.53 g/mol. Its IUPAC name is (8R,9R,10R,14R)-17-isothiocyanato-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9R,10R,14R)-17-isothiocyanato-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 167089420 |
| Molecular Formula | C20H29NOS |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (8R,9R,10R,14R)-17-isothiocyanato-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | CC12CC[C@@H]3[C@@H](CC=C4CCCC[C@@]43C)[C@H]1CCC2(O)N=C=S |
| InChI | InChI=1S/C20H29NOS/c1-18-10-4-3-5-14(18)6-7-15-16(18)8-11-19(2)17(15)9-12-20(19,22)21-13-23/h6,15-17,22H,3-5,7-12H2,1-2H3/t15-,16-,17-,18+,19?,20?/m1/s1 |
| InChIKey | DOEOABGFTWHOAS-GTUQPRBKSA-N |
| XLogP | 5.13 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|