C31H57N3S2 — CID 155426881
2-[2-[[(4aS)-8-(4,8-dimethylnonyl)-4a,7,7-trimethyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl]disulfanyl]ethyl]guanidine (PubChem CID 155426881) has the molecular formula C31H57N3S2 and a molecular weight of 535.95 g/mol. Its IUPAC name is 2-[2-[[(4aS)-8-(4,8-dimethylnonyl)-4a,7,7-trimethyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl]disulfanyl]ethyl]guanidine.
| Compound Name | 2-[2-[[(4aS)-8-(4,8-dimethylnonyl)-4a,7,7-trimethyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl]disulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 155426881 |
| Molecular Formula | C31H57N3S2 |
| Molecular Weight | 535.95 g/mol |
| Exact Mass | 535.40 |
| IUPAC Name | 2-[2-[[(4aS)-8-(4,8-dimethylnonyl)-4a,7,7-trimethyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl]disulfanyl]ethyl]guanidine |
| SMILES | CC(C)CCCC(C)CCCC1C2CC=C3CC(SSCCN=C(N)N)CC[C@@]3(C)C2CCC1(C)C |
| InChI | InChI=1S/C31H57N3S2/c1-22(2)9-7-10-23(3)11-8-12-27-26-14-13-24-21-25(36-35-20-19-34-29(32)33)15-18-31(24,6)28(26)16-17-30(27,4)5/h13,22-23,25-28H,7-12,14-21H2,1-6H3,(H4,32,33,34)/t23?,25?,26?,27?,28?,31-/m1/s1 |
| InChIKey | LUYHRBWXVPUGTC-URWUQGQLSA-N |
| XLogP | 8.83 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.95 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|