C22H34O3 — CID 22832205
[6-[(3aS,4R,5S,8aR)-4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-2-methylhept-2-en-4-yl] acetate (PubChem CID 22832205) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [6-[(3aS,4R,5S,8aR)-4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-2-methylhept-2-en-4-yl] acetate.
| Compound Name | [6-[(3aS,4R,5S,8aR)-4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-2-methylhept-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 22832205 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [6-[(3aS,4R,5S,8aR)-4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-2-methylhept-2-en-4-yl] acetate |
| SMILES | C=C1CC[C@@H](C(C)CC(C=C(C)C)OC(C)=O)[C@@H](O)[C@@H]2C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C22H34O3/c1-13(2)11-18(25-17(6)23)12-16(5)20-10-7-14(3)19-9-8-15(4)21(19)22(20)24/h8,11,16,18-22,24H,3,7,9-10,12H2,1-2,4-6H3/t16?,18?,19-,20-,21+,22+/m0/s1 |
| InChIKey | SCPIFSIRADMOGZ-CKXOTEMFSA-N |
| XLogP | 4.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|