C22H34O5 — CID 22832766
[(E)-2-[(3aS,4R,5S,7R,8aR)-4,7-dihydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-6-hydroxy-6-methylhept-4-en-3-yl] acetate (PubChem CID 22832766) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(E)-2-[(3aS,4R,5S,7R,8aR)-4,7-dihydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-6-hydroxy-6-methylhept-4-en-3-yl] acetate.
| Compound Name | [(E)-2-[(3aS,4R,5S,7R,8aR)-4,7-dihydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-6-hydroxy-6-methylhept-4-en-3-yl] acetate |
|---|---|
| PubChem CID | 22832766 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(E)-2-[(3aS,4R,5S,7R,8aR)-4,7-dihydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl]-6-hydroxy-6-methylhept-4-en-3-yl] acetate |
| SMILES | C=C1[C@H](O)C[C@@H](C(C)C(/C=C/C(C)(C)O)OC(C)=O)[C@@H](O)[C@@H]2C(C)=CC[C@@H]12 |
| InChI | InChI=1S/C22H34O5/c1-12-7-8-16-13(2)18(24)11-17(21(25)20(12)16)14(3)19(27-15(4)23)9-10-22(5,6)26/h7,9-10,14,16-21,24-26H,2,8,11H2,1,3-6H3/b10-9+/t14?,16-,17-,18+,19?,20+,21+/m0/s1 |
| InChIKey | ITHXYSLFNLWDTL-YBHFRAIFSA-N |
| XLogP | 2.76 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|