C22H26O9 — CID 163040447
(14-methyl-5-methylidene-4,10-dioxo-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadec-13-en-7-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate (PubChem CID 163040447) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is (14-methyl-5-methylidene-4,10-dioxo-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadec-13-en-7-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate.
| Compound Name | (14-methyl-5-methylidene-4,10-dioxo-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadec-13-en-7-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 163040447 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (14-methyl-5-methylidene-4,10-dioxo-3,11-dioxatetracyclo[7.5.1.02,6.012,15]pentadec-13-en-7-yl) 3-acetyloxy-2-hydroxy-2-methylbutanoate |
| SMILES | C=C1C(=O)OC2C1C(OC(=O)C(C)(O)C(C)OC(C)=O)CC1C(=O)OC3C=C(C)C2C31 |
| InChI | InChI=1S/C22H26O9/c1-8-6-13-17-12(20(25)29-13)7-14(16-9(2)19(24)31-18(16)15(8)17)30-21(26)22(5,27)10(3)28-11(4)23/h6,10,12-18,27H,2,7H2,1,3-5H3 |
| InChIKey | YRBJVYDMJRCQJB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|