C20H32O3 — CID 163094003
6-(4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl)-2-methylhept-3-ene-2,6-diol (PubChem CID 163094003) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 6-(4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl)-2-methylhept-3-ene-2,6-diol.
| Compound Name | 6-(4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl)-2-methylhept-3-ene-2,6-diol |
|---|---|
| PubChem CID | 163094003 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 6-(4-hydroxy-3-methyl-8-methylidene-3a,4,5,6,7,8a-hexahydro-1H-azulen-5-yl)-2-methylhept-3-ene-2,6-diol |
| SMILES | C=C1CCC(C(C)(O)CC=CC(C)(C)O)C(O)C2C(C)=CCC12 |
| InChI | InChI=1S/C20H32O3/c1-13-8-10-16(18(21)17-14(2)7-9-15(13)17)20(5,23)12-6-11-19(3,4)22/h6-7,11,15-18,21-23H,1,8-10,12H2,2-5H3 |
| InChIKey | SZCSQVCKEKGMCP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|