C26H38O8 — CID 162930434
[2-methyl-6-(2,5,6-triacetyloxy-4-methylcyclohex-3-en-1-yl)hept-2-en-4-yl] 2-methylbut-2-enoate (PubChem CID 162930434) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is [2-methyl-6-(2,5,6-triacetyloxy-4-methylcyclohex-3-en-1-yl)hept-2-en-4-yl] 2-methylbut-2-enoate.
| Compound Name | [2-methyl-6-(2,5,6-triacetyloxy-4-methylcyclohex-3-en-1-yl)hept-2-en-4-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162930434 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [2-methyl-6-(2,5,6-triacetyloxy-4-methylcyclohex-3-en-1-yl)hept-2-en-4-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC(C=C(C)C)CC(C)C1C(OC(C)=O)C=C(C)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C26H38O8/c1-10-15(4)26(30)34-21(11-14(2)3)12-16(5)23-22(31-18(7)27)13-17(6)24(32-19(8)28)25(23)33-20(9)29/h10-11,13,16,21-25H,12H2,1-9H3 |
| InChIKey | HIOQBMNUCHNSHW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|