C22H32O8 — CID 162954527
(3R,4R,5S)-5-acetyloxy-4-[(E)-2-methylbut-2-enoyl]oxy-3-(6-methylheptanoyloxy)cyclohexene-1-carboxylic acid (PubChem CID 162954527) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is (3R,4R,5S)-5-acetyloxy-4-[(E)-2-methylbut-2-enoyl]oxy-3-(6-methylheptanoyloxy)cyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-5-acetyloxy-4-[(E)-2-methylbut-2-enoyl]oxy-3-(6-methylheptanoyloxy)cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 162954527 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (3R,4R,5S)-5-acetyloxy-4-[(E)-2-methylbut-2-enoyl]oxy-3-(6-methylheptanoyloxy)cyclohexene-1-carboxylic acid |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1[C@@H](OC(C)=O)CC(C(=O)O)=C[C@H]1OC(=O)CCCCC(C)C |
| InChI | InChI=1S/C22H32O8/c1-6-14(4)22(27)30-20-17(28-15(5)23)11-16(21(25)26)12-18(20)29-19(24)10-8-7-9-13(2)3/h6,12-13,17-18,20H,7-11H2,1-5H3,(H,25,26)/b14-6+/t17-,18+,20+/m0/s1 |
| InChIKey | RDYSWCHNPYLMIQ-UTPBTOHWSA-N |
| XLogP | 3.34 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|