C24H34O7 — CID 162993908
[(1R,2S,4aR,6S,8S,8aS)-2,8-diacetyloxy-8a-(hydroxymethyl)-4-methyl-6-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (E)-2-methylbut-2-enoate (PubChem CID 162993908) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(1R,2S,4aR,6S,8S,8aS)-2,8-diacetyloxy-8a-(hydroxymethyl)-4-methyl-6-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,4aR,6S,8S,8aS)-2,8-diacetyloxy-8a-(hydroxymethyl)-4-methyl-6-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162993908 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(1R,2S,4aR,6S,8S,8aS)-2,8-diacetyloxy-8a-(hydroxymethyl)-4-methyl-6-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-1-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=C(C)[C@@H]1C[C@H](OC(C)=O)[C@@]2(CO)[C@H](C1)C(C)=C[C@H](OC(C)=O)[C@@H]2OC(=O)/C(C)=C/C |
| InChI | InChI=1S/C24H34O7/c1-8-14(4)23(28)31-22-20(29-16(6)26)9-15(5)19-10-18(13(2)3)11-21(30-17(7)27)24(19,22)12-25/h8-9,18-22,25H,2,10-12H2,1,3-7H3/b14-8+/t18-,19+,20-,21-,22-,24+/m0/s1 |
| InChIKey | CDALOONAMBNUSI-LZUSEWBZSA-N |
| XLogP | 3.27 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|