C24H30O3Se — CID 10863194
Se-phenyl (5E,9E)-5,9-dimethyl-12-(5-oxo-2H-furan-4-yl)dodeca-5,9-dieneselenoate (PubChem CID 10863194) has the molecular formula C24H30O3Se and a molecular weight of 445.46 g/mol. Its IUPAC name is Se-phenyl (5E,9E)-5,9-dimethyl-12-(5-oxo-2H-furan-4-yl)dodeca-5,9-dieneselenoate.
| Compound Name | Se-phenyl (5E,9E)-5,9-dimethyl-12-(5-oxo-2H-furan-4-yl)dodeca-5,9-dieneselenoate |
|---|---|
| PubChem CID | 10863194 |
| Molecular Formula | C24H30O3Se |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | Se-phenyl (5E,9E)-5,9-dimethyl-12-(5-oxo-2H-furan-4-yl)dodeca-5,9-dieneselenoate |
| SMILES | C/C(=C\CCC1=CCOC1=O)CC/C=C(\C)CCCC(=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C24H30O3Se/c1-19(11-7-13-21-17-18-27-24(21)26)9-6-10-20(2)12-8-16-23(25)28-22-14-4-3-5-15-22/h3-5,10-11,14-15,17H,6-9,12-13,16,18H2,1-2H3/b19-11+,20-10+ |
| InChIKey | SIUHSOLITXLWQT-CWGBCDKESA-N |
| XLogP | 4.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|