C16H22OSe — CID 71412008
2,6-dimethyl-8-phenylselanylocta-2,6-dien-1-ol (PubChem CID 71412008) has the molecular formula C16H22OSe and a molecular weight of 309.31 g/mol. Its IUPAC name is 2,6-dimethyl-8-phenylselanylocta-2,6-dien-1-ol.
| Compound Name | 2,6-dimethyl-8-phenylselanylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 71412008 |
| Molecular Formula | C16H22OSe |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2,6-dimethyl-8-phenylselanylocta-2,6-dien-1-ol |
| SMILES | CC(=CCCC(C)=CC[Se]c1ccccc1)CO |
| InChI | InChI=1S/C16H22OSe/c1-14(7-6-8-15(2)13-17)11-12-18-16-9-4-3-5-10-16/h3-5,8-11,17H,6-7,12-13H2,1-2H3 |
| InChIKey | PLIOMQVQSZEZTE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|