C29H44O2 — CID 91227290
8-ethyl-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 91227290) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is 8-ethyl-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | 8-ethyl-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 91227290 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | 8-ethyl-2,6,10,14-tetramethyl-16-phenylmethoxyhexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | CCC(C=C(C)CCC=C(C)CO)CC(C)=CCCC(C)=CCOCc1ccccc1 |
| InChI | InChI=1S/C29H44O2/c1-6-28(21-26(4)14-11-15-27(5)22-30)20-25(3)13-10-12-24(2)18-19-31-23-29-16-8-7-9-17-29/h7-9,13,15-18,21,28,30H,6,10-12,14,19-20,22-23H2,1-5H3 |
| InChIKey | MJBNEGJJEYJDMF-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|