C25H37NO3 — CID 15664331
ethyl (2E,6Z,10E)-4-(dimethylamino)-6,10-dimethyl-12-phenylmethoxydodeca-2,6,10-trienoate (PubChem CID 15664331) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is ethyl (2E,6Z,10E)-4-(dimethylamino)-6,10-dimethyl-12-phenylmethoxydodeca-2,6,10-trienoate.
| Compound Name | ethyl (2E,6Z,10E)-4-(dimethylamino)-6,10-dimethyl-12-phenylmethoxydodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 15664331 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | ethyl (2E,6Z,10E)-4-(dimethylamino)-6,10-dimethyl-12-phenylmethoxydodeca-2,6,10-trienoate |
| SMILES | CCOC(=O)/C=C/C(C/C(C)=C\CC/C(C)=C/COCc1ccccc1)N(C)C |
| InChI | InChI=1S/C25H37NO3/c1-6-29-25(27)16-15-24(26(4)5)19-22(3)12-10-11-21(2)17-18-28-20-23-13-8-7-9-14-23/h7-9,12-17,24H,6,10-11,18-20H2,1-5H3/b16-15+,21-17+,22-12- |
| InChIKey | LBBLGOQSFXIGAN-VRZCKWMVSA-N |
| XLogP | 5.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|